C14H13ClN4O5S — CID 88715719
(5-chloro-4,6-dimethylpyrimidin-2-yl)carbamoyl 2-sulfamoylbenzoate (PubChem CID 88715719) has the molecular formula C14H13ClN4O5S and a molecular weight of 384.80 g/mol. Its IUPAC name is (5-chloro-4,6-dimethylpyrimidin-2-yl)carbamoyl 2-sulfamoylbenzoate.
| Compound Name | (5-chloro-4,6-dimethylpyrimidin-2-yl)carbamoyl 2-sulfamoylbenzoate |
|---|---|
| PubChem CID | 88715719 |
| Molecular Formula | C14H13ClN4O5S |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | (5-chloro-4,6-dimethylpyrimidin-2-yl)carbamoyl 2-sulfamoylbenzoate |
| SMILES | Cc1nc(NC(=O)OC(=O)c2ccccc2S(N)(=O)=O)nc(C)c1Cl |
| InChI | InChI=1S/C14H13ClN4O5S/c1-7-11(15)8(2)18-13(17-7)19-14(21)24-12(20)9-5-3-4-6-10(9)25(16,22)23/h3-6H,1-2H3,(H2,16,22,23)(H,17,18,19,21) |
| InChIKey | BCEANOJSNAQTDB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|