About N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide
N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide (PubChem CID 57124828) has the molecular formula C14H17N5O5S2
and a molecular weight of 399.45 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide.
Molecular Properties
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide |
| PubChem CID | 57124828 |
| Molecular Formula | C14H17N5O5S2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1cc(C)nc(NC(=O)CNS(=O)(=O)c2ccccc2S(N)(=O)=O)n1 |
| InChI | InChI=1S/C14H17N5O5S2/c1-9-7-10(2)18-14(17-9)19-13(20)8-16-26(23,24)12-6-4-3-5-11(12)25(15,21)22/h3-7,16H,8H2,1-2H3,(H2,15,21,22)(H,17,18,19,20) |
| InChIKey | FRVUBTNFXSEXCH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide?
The IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide (CID 57124828) is N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide.
What is the SMILES notation for N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide?
The canonical SMILES for N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide is Cc1cc(C)nc(NC(=O)CNS(=O)(=O)c2ccccc2S(N)(=O)=O)n1.
What is the InChIKey of N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide?
The InChIKey is FRVUBTNFXSEXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O5S2/c1-9-7-10(2)18-14(17-9)19-13(20)8-16-26(23,24)12-6-4-3-5-11(12)25(15,21)22/h3-7,16H,8H2,1-2H3,(H2,15,21,22)(H,17,18,19,20).
What are the key properties of N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide?
N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide has a molecular weight of 399.45 g/mol, XLogP of -0.34, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethylpyrimidin-2-yl)-2-[(2-sulfamoylphenyl)sulfonylamino]acetamide is sourced from PubChem (CID 57124828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).