C7H12O4 — CID 175228464
2-(dioxolan-3-yl)-2-methyl-1,3-dioxolane (PubChem CID 175228464) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-(dioxolan-3-yl)-2-methyl-1,3-dioxolane.
| Compound Name | 2-(dioxolan-3-yl)-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 175228464 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-(dioxolan-3-yl)-2-methyl-1,3-dioxolane |
| SMILES | CC1(C2CCOO2)OCCO1 |
| InChI | InChI=1S/C7H12O4/c1-7(8-4-5-9-7)6-2-3-10-11-6/h6H,2-5H2,1H3 |
| InChIKey | VZXJXUCQQQHWCR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|