C24H19N3O6 — CID 175230246
4-[2-(4-benzoyloxy-2-hydroxyphenyl)benzotriazol-5-yl]oxy-2-methylidenebutanoic acid (PubChem CID 175230246) has the molecular formula C24H19N3O6 and a molecular weight of 445.43 g/mol. Its IUPAC name is 4-[2-(4-benzoyloxy-2-hydroxyphenyl)benzotriazol-5-yl]oxy-2-methylidenebutanoic acid.
| Compound Name | 4-[2-(4-benzoyloxy-2-hydroxyphenyl)benzotriazol-5-yl]oxy-2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 175230246 |
| Molecular Formula | C24H19N3O6 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 4-[2-(4-benzoyloxy-2-hydroxyphenyl)benzotriazol-5-yl]oxy-2-methylidenebutanoic acid |
| SMILES | C=C(CCOc1ccc2nn(-c3ccc(OC(=O)c4ccccc4)cc3O)nc2c1)C(=O)O |
| InChI | InChI=1S/C24H19N3O6/c1-15(23(29)30)11-12-32-17-7-9-19-20(13-17)26-27(25-19)21-10-8-18(14-22(21)28)33-24(31)16-5-3-2-4-6-16/h2-10,13-14,28H,1,11-12H2,(H,29,30) |
| InChIKey | QJMURBAXVBJKRF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|