About 2-pentyl-1H-phenalene
2-pentyl-1H-phenalene (PubChem CID 175230709) has the molecular formula C18H20
and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-pentyl-1H-phenalene.
Molecular Properties
| Compound Name | 2-pentyl-1H-phenalene |
| PubChem CID | 175230709 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-pentyl-1H-phenalene |
| SMILES | CCCCCC1=Cc2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C18H20/c1-2-3-4-7-14-12-16-10-5-8-15-9-6-11-17(13-14)18(15)16/h5-6,8-12H,2-4,7,13H2,1H3 |
| InChIKey | GFGTZMZTSLJWFS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-1H-phenalene?
The IUPAC name of 2-pentyl-1H-phenalene (CID 175230709) is 2-pentyl-1H-phenalene.
What is the SMILES notation for 2-pentyl-1H-phenalene?
The canonical SMILES for 2-pentyl-1H-phenalene is CCCCCC1=Cc2cccc3cccc(c23)C1.
What is the InChIKey of 2-pentyl-1H-phenalene?
The InChIKey is GFGTZMZTSLJWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20/c1-2-3-4-7-14-12-16-10-5-8-15-9-6-11-17(13-14)18(15)16/h5-6,8-12H,2-4,7,13H2,1H3.
What are the key properties of 2-pentyl-1H-phenalene?
2-pentyl-1H-phenalene has a molecular weight of 236.36 g/mol, XLogP of 5.36, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-1H-phenalene is sourced from PubChem (CID 175230709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).