About dec-1-ene;1H-phenalene
dec-1-ene;1H-phenalene (PubChem CID 174935636) has the molecular formula C23H30
and a molecular weight of 306.49 g/mol. Its IUPAC name is dec-1-ene;1H-phenalene.
Molecular Properties
| Compound Name | dec-1-ene;1H-phenalene |
| PubChem CID | 174935636 |
| Molecular Formula | C23H30 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | dec-1-ene;1H-phenalene |
| SMILES | C1=Cc2cccc3cccc(c23)C1.C=CCCCCCCCC |
| InChI | InChI=1S/C13H10.C10H20/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-3-5-7-9-10-8-6-4-2/h1-8H,9H2;3H,1,4-10H2,2H3 |
| InChIKey | NAFKTLXMZTXDNL-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dec-1-ene;1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-1-ene;1H-phenalene?
The IUPAC name of dec-1-ene;1H-phenalene (CID 174935636) is dec-1-ene;1H-phenalene.
What is the SMILES notation for dec-1-ene;1H-phenalene?
The canonical SMILES for dec-1-ene;1H-phenalene is C1=Cc2cccc3cccc(c23)C1.C=CCCCCCCCC.
What is the InChIKey of dec-1-ene;1H-phenalene?
The InChIKey is NAFKTLXMZTXDNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C10H20/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-3-5-7-9-10-8-6-4-2/h1-8H,9H2;3H,1,4-10H2,2H3.
What are the key properties of dec-1-ene;1H-phenalene?
dec-1-ene;1H-phenalene has a molecular weight of 306.49 g/mol, XLogP of 7.33, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dec-1-ene;1H-phenalene is sourced from PubChem (CID 174935636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).