C13H12N4S — CID 175231126
6-(thionin-2-yl)-6,7-dihydro-3H-purine (PubChem CID 175231126) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 6-(thionin-2-yl)-6,7-dihydro-3H-purine.
| Compound Name | 6-(thionin-2-yl)-6,7-dihydro-3H-purine |
|---|---|
| PubChem CID | 175231126 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 6-(thionin-2-yl)-6,7-dihydro-3H-purine |
| SMILES | C1=NC(c2cccccccs2)c2[nH]cnc2N1 |
| InChI | InChI=1S/C13H12N4S/c1-2-4-6-10(18-7-5-3-1)11-12-13(16-8-14-11)17-9-15-12/h1-9,11H,(H,14,16)(H,15,17)/b3-1-,4-2-,7-5-,10-6- |
| InChIKey | DXIVGWUGLJQHOF-AMXHOLOFSA-N |
| XLogP | 3.14 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |