C13H16O — CID 175232409
5-but-3-en-2-yl-2,3-dihydro-1H-inden-4-ol (PubChem CID 175232409) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 5-but-3-en-2-yl-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 5-but-3-en-2-yl-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 175232409 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 5-but-3-en-2-yl-2,3-dihydro-1H-inden-4-ol |
| SMILES | C=CC(C)c1ccc2c(c1O)CCC2 |
| InChI | InChI=1S/C13H16O/c1-3-9(2)11-8-7-10-5-4-6-12(10)13(11)14/h3,7-9,14H,1,4-6H2,2H3 |
| InChIKey | RFPZUKRVJLKLEE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|