C12H17N5 — CID 175234712
1-(diaminomethylidene)-2-[3,6-di(ethylidene)cyclohexa-1,4-dien-1-yl]guanidine (PubChem CID 175234712) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3,6-di(ethylidene)cyclohexa-1,4-dien-1-yl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3,6-di(ethylidene)cyclohexa-1,4-dien-1-yl]guanidine |
|---|---|
| PubChem CID | 175234712 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3,6-di(ethylidene)cyclohexa-1,4-dien-1-yl]guanidine |
| SMILES | CC=c1ccc(=CC)c(/N=C(\N)N=C(N)N)c1 |
| InChI | InChI=1S/C12H17N5/c1-3-8-5-6-9(4-2)10(7-8)16-12(15)17-11(13)14/h3-7H,1-2H3,(H6,13,14,15,16,17) |
| InChIKey | VIGXNPLJMPTJDK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|