C15H18N2O4 — CID 175238294
5-(aminomethyl)-2-ethyl-3-imino-4,6-dioxo-6-phenylhexanoic acid (PubChem CID 175238294) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-(aminomethyl)-2-ethyl-3-imino-4,6-dioxo-6-phenylhexanoic acid.
| Compound Name | 5-(aminomethyl)-2-ethyl-3-imino-4,6-dioxo-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 175238294 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5-(aminomethyl)-2-ethyl-3-imino-4,6-dioxo-6-phenylhexanoic acid |
| SMILES | [H]/N=C(/C(=O)C(CN)C(=O)c1ccccc1)C(CC)C(=O)O |
| InChI | InChI=1S/C15H18N2O4/c1-2-10(15(20)21)12(17)14(19)11(8-16)13(18)9-6-4-3-5-7-9/h3-7,10-11,17H,2,8,16H2,1H3,(H,20,21)/b17-12+ |
| InChIKey | FBVSNZLYCQPIHI-SFQUDFHCSA-N |
| XLogP | 1.14 |
| TPSA | 121.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|