About 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol
2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol (PubChem CID 175240199) has the molecular formula C23H28O2
and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol.
Molecular Properties
| Compound Name | 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol |
| PubChem CID | 175240199 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol |
| SMILES | CCCCCCO.c1ccc2cc3c(CC4CO4)cccc3cc2c1 |
| InChI | InChI=1S/C17H14O.C6H14O/c1-2-5-13-10-17-14(8-12(13)4-1)6-3-7-15(17)9-16-11-18-16;1-2-3-4-5-6-7/h1-8,10,16H,9,11H2;7H,2-6H2,1H3 |
| InChIKey | MWDPBBLVYOIDCF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol?
The IUPAC name of 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol (CID 175240199) is 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol.
What is the SMILES notation for 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol?
The canonical SMILES for 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol is CCCCCCO.c1ccc2cc3c(CC4CO4)cccc3cc2c1.
What is the InChIKey of 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol?
The InChIKey is MWDPBBLVYOIDCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O.C6H14O/c1-2-5-13-10-17-14(8-12(13)4-1)6-3-7-15(17)9-16-11-18-16;1-2-3-4-5-6-7/h1-8,10,16H,9,11H2;7H,2-6H2,1H3.
What are the key properties of 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol?
2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol has a molecular weight of 336.48 g/mol, XLogP of 5.49, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(anthracen-1-ylmethyl)oxirane;hexan-1-ol is sourced from PubChem (CID 175240199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).