C28H32F3N3O5 — CID 175240964
N-hydroxy-2-[3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluorophenoxy)ethyl]piperidine-4-carboxamide (PubChem CID 175240964) has the molecular formula C28H32F3N3O5 and a molecular weight of 547.57 g/mol. Its IUPAC name is N-hydroxy-2-[3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluorophenoxy)ethyl]piperidine-4-carboxamide.
| Compound Name | N-hydroxy-2-[3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluorophenoxy)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 175240964 |
| Molecular Formula | C28H32F3N3O5 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | N-hydroxy-2-[3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluorophenoxy)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CO)c(CCCC3CC(C(=O)NO)CCN3CCOc3c(F)cc(F)cc3F)c2c1 |
| InChI | InChI=1S/C28H32F3N3O5/c1-38-21-5-6-26-23(14-21)22(18(16-35)15-32-26)4-2-3-20-11-17(28(36)33-37)7-8-34(20)9-10-39-27-24(30)12-19(29)13-25(27)31/h5-6,12-15,17,20,35,37H,2-4,7-11,16H2,1H3,(H,33,36) |
| InChIKey | NAIIRDSLFQQAJL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|