C27H29F4N3O4 — CID 174452056
2-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide (PubChem CID 174452056) has the molecular formula C27H29F4N3O4 and a molecular weight of 535.54 g/mol. Its IUPAC name is 2-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide.
| Compound Name | 2-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 174452056 |
| Molecular Formula | C27H29F4N3O4 |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 2-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(F)c(CCCC3CC(C(=O)NO)CCN3CCOc3cc(F)c(F)c(F)c3)c2c1 |
| InChI | InChI=1S/C27H29F4N3O4/c1-37-18-5-6-25-21(12-18)20(24(30)15-32-25)4-2-3-17-11-16(27(35)33-36)7-8-34(17)9-10-38-19-13-22(28)26(31)23(29)14-19/h5-6,12-17,36H,2-4,7-11H2,1H3,(H,33,35) |
| InChIKey | ASBMXAXYINYJIK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|