C28H33F3N4O3 — CID 174464683
2-[3-(3-amino-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide (PubChem CID 174464683) has the molecular formula C28H33F3N4O3 and a molecular weight of 530.59 g/mol. Its IUPAC name is 2-[3-(3-amino-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 2-[3-(3-amino-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 174464683 |
| Molecular Formula | C28H33F3N4O3 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 2-[3-(3-amino-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(N)c(CCCC3CC(C(=O)NO)CCN3CCCc3cc(F)c(F)c(F)c3)c2c1 |
| InChI | InChI=1S/C28H33F3N4O3/c1-38-20-7-8-26-22(15-20)21(25(32)16-33-26)6-2-5-19-14-18(28(36)34-37)9-11-35(19)10-3-4-17-12-23(29)27(31)24(30)13-17/h7-8,12-13,15-16,18-19,37H,2-6,9-11,14,32H2,1H3,(H,34,36) |
| InChIKey | XKDYSOFQMPLFFZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|