C28H29FN2O5 — CID 69346172
2-[4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-phenylmethoxycarbonylpiperidin-3-ylidene]acetic acid (PubChem CID 69346172) has the molecular formula C28H29FN2O5 and a molecular weight of 492.55 g/mol. Its IUPAC name is 2-[4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-phenylmethoxycarbonylpiperidin-3-ylidene]acetic acid.
| Compound Name | 2-[4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-phenylmethoxycarbonylpiperidin-3-ylidene]acetic acid |
|---|---|
| PubChem CID | 69346172 |
| Molecular Formula | C28H29FN2O5 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 2-[4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-phenylmethoxycarbonylpiperidin-3-ylidene]acetic acid |
| SMILES | COc1ccc2ncc(F)c(CCCC3CCN(C(=O)OCc4ccccc4)CC3=CC(=O)O)c2c1 |
| InChI | InChI=1S/C28H29FN2O5/c1-35-22-10-11-26-24(15-22)23(25(29)16-30-26)9-5-8-20-12-13-31(17-21(20)14-27(32)33)28(34)36-18-19-6-3-2-4-7-19/h2-4,6-7,10-11,14-16,20H,5,8-9,12-13,17-18H2,1H3,(H,32,33) |
| InChIKey | VPJPXRCEFRVNOB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|