C24H21N5O2 — CID 175242210
2-[4-[2-(methylamino)-2-oxoethyl]-1-phenylimidazol-2-yl]-3-pyridin-4-ylbenzamide (PubChem CID 175242210) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 2-[4-[2-(methylamino)-2-oxoethyl]-1-phenylimidazol-2-yl]-3-pyridin-4-ylbenzamide.
| Compound Name | 2-[4-[2-(methylamino)-2-oxoethyl]-1-phenylimidazol-2-yl]-3-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 175242210 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[4-[2-(methylamino)-2-oxoethyl]-1-phenylimidazol-2-yl]-3-pyridin-4-ylbenzamide |
| SMILES | CNC(=O)Cc1cn(-c2ccccc2)c(-c2c(C(N)=O)cccc2-c2ccncc2)n1 |
| InChI | InChI=1S/C24H21N5O2/c1-26-21(30)14-17-15-29(18-6-3-2-4-7-18)24(28-17)22-19(16-10-12-27-13-11-16)8-5-9-20(22)23(25)31/h2-13,15H,14H2,1H3,(H2,25,31)(H,26,30) |
| InChIKey | QUPZEYJBCJIAMM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |