C17H17F3N4S — CID 175243310
1-[2-(aminomethyl)phenyl]-N-phenyl-3-(trifluoromethyl)pyrazol-5-amine;sulfane (PubChem CID 175243310) has the molecular formula C17H17F3N4S and a molecular weight of 366.41 g/mol. Its IUPAC name is 1-[2-(aminomethyl)phenyl]-N-phenyl-3-(trifluoromethyl)pyrazol-5-amine;sulfane.
| Compound Name | 1-[2-(aminomethyl)phenyl]-N-phenyl-3-(trifluoromethyl)pyrazol-5-amine;sulfane |
|---|---|
| PubChem CID | 175243310 |
| Molecular Formula | C17H17F3N4S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-[2-(aminomethyl)phenyl]-N-phenyl-3-(trifluoromethyl)pyrazol-5-amine;sulfane |
| SMILES | NCc1ccccc1-n1nc(C(F)(F)F)cc1Nc1ccccc1.S |
| InChI | InChI=1S/C17H15F3N4.H2S/c18-17(19,20)15-10-16(22-13-7-2-1-3-8-13)24(23-15)14-9-5-4-6-12(14)11-21;/h1-10,22H,11,21H2;1H2 |
| InChIKey | XKZXXNHDXHQGDK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |