C17H16F3N5O2S — CID 174572060
2-[[1-[2-(aminomethyl)phenyl]-3-(trifluoromethyl)pyrazol-5-yl]amino]benzenesulfonamide (PubChem CID 174572060) has the molecular formula C17H16F3N5O2S and a molecular weight of 411.41 g/mol. Its IUPAC name is 2-[[1-[2-(aminomethyl)phenyl]-3-(trifluoromethyl)pyrazol-5-yl]amino]benzenesulfonamide.
| Compound Name | 2-[[1-[2-(aminomethyl)phenyl]-3-(trifluoromethyl)pyrazol-5-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 174572060 |
| Molecular Formula | C17H16F3N5O2S |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-[[1-[2-(aminomethyl)phenyl]-3-(trifluoromethyl)pyrazol-5-yl]amino]benzenesulfonamide |
| SMILES | NCc1ccccc1-n1nc(C(F)(F)F)cc1Nc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C17H16F3N5O2S/c18-17(19,20)15-9-16(23-12-6-2-4-8-14(12)28(22,26)27)25(24-15)13-7-3-1-5-11(13)10-21/h1-9,23H,10,21H2,(H2,22,26,27) |
| InChIKey | NSDDLLFIBGIQHP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |