C26H26ClN3O — CID 175244870
4-[1-[5-(4-chloro-2-methylphenyl)indazol-1-yl]-3-methylbutyl]benzamide (PubChem CID 175244870) has the molecular formula C26H26ClN3O and a molecular weight of 431.97 g/mol. Its IUPAC name is 4-[1-[5-(4-chloro-2-methylphenyl)indazol-1-yl]-3-methylbutyl]benzamide.
| Compound Name | 4-[1-[5-(4-chloro-2-methylphenyl)indazol-1-yl]-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 175244870 |
| Molecular Formula | C26H26ClN3O |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 4-[1-[5-(4-chloro-2-methylphenyl)indazol-1-yl]-3-methylbutyl]benzamide |
| SMILES | Cc1cc(Cl)ccc1-c1ccc2c(cnn2C(CC(C)C)c2ccc(C(N)=O)cc2)c1 |
| InChI | InChI=1S/C26H26ClN3O/c1-16(2)12-25(18-4-6-19(7-5-18)26(28)31)30-24-11-8-20(14-21(24)15-29-30)23-10-9-22(27)13-17(23)3/h4-11,13-16,25H,12H2,1-3H3,(H2,28,31) |
| InChIKey | PZBWTOXLUNTNNF-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |