C25H23Cl2N3O — CID 175244915
5-[1-[6-chloro-5-(4-chloro-2-methylphenyl)indazol-1-yl]-3-methylbutyl]pyridine-2-carbaldehyde (PubChem CID 175244915) has the molecular formula C25H23Cl2N3O and a molecular weight of 452.39 g/mol. Its IUPAC name is 5-[1-[6-chloro-5-(4-chloro-2-methylphenyl)indazol-1-yl]-3-methylbutyl]pyridine-2-carbaldehyde.
| Compound Name | 5-[1-[6-chloro-5-(4-chloro-2-methylphenyl)indazol-1-yl]-3-methylbutyl]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 175244915 |
| Molecular Formula | C25H23Cl2N3O |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 5-[1-[6-chloro-5-(4-chloro-2-methylphenyl)indazol-1-yl]-3-methylbutyl]pyridine-2-carbaldehyde |
| SMILES | Cc1cc(Cl)ccc1-c1cc2cnn(C(CC(C)C)c3ccc(C=O)nc3)c2cc1Cl |
| InChI | InChI=1S/C25H23Cl2N3O/c1-15(2)8-24(17-4-6-20(14-31)28-12-17)30-25-11-23(27)22(10-18(25)13-29-30)21-7-5-19(26)9-16(21)3/h4-7,9-15,24H,8H2,1-3H3 |
| InChIKey | NCPGSRSVVKABGJ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|