C31H32F3N3O3 — CID 175244965
[3-carbamoyl-4-[(1S)-3-methyl-1-[6-methyl-5-[2-methyl-4-(trifluoromethyl)phenyl]indazol-1-yl]butyl]phenyl] propanoate (PubChem CID 175244965) has the molecular formula C31H32F3N3O3 and a molecular weight of 551.61 g/mol. Its IUPAC name is [3-carbamoyl-4-[(1S)-3-methyl-1-[6-methyl-5-[2-methyl-4-(trifluoromethyl)phenyl]indazol-1-yl]butyl]phenyl] propanoate.
| Compound Name | [3-carbamoyl-4-[(1S)-3-methyl-1-[6-methyl-5-[2-methyl-4-(trifluoromethyl)phenyl]indazol-1-yl]butyl]phenyl] propanoate |
|---|---|
| PubChem CID | 175244965 |
| Molecular Formula | C31H32F3N3O3 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | [3-carbamoyl-4-[(1S)-3-methyl-1-[6-methyl-5-[2-methyl-4-(trifluoromethyl)phenyl]indazol-1-yl]butyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc([C@H](CC(C)C)n2ncc3cc(-c4ccc(C(F)(F)F)cc4C)c(C)cc32)c(C(N)=O)c1 |
| InChI | InChI=1S/C31H32F3N3O3/c1-6-29(38)40-22-8-10-24(26(15-22)30(35)39)28(11-17(2)3)37-27-13-19(5)25(14-20(27)16-36-37)23-9-7-21(12-18(23)4)31(32,33)34/h7-10,12-17,28H,6,11H2,1-5H3,(H2,35,39)/t28-/m0/s1 |
| InChIKey | UBLCFAGHMMYZJE-NDEPHWFRSA-N |
| XLogP | 7.39 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|