C22H22N2 — CID 175245625
3,4,10,10a-tetrahydrochrysene;1,2-dihydropyrazine (PubChem CID 175245625) has the molecular formula C22H22N2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 3,4,10,10a-tetrahydrochrysene;1,2-dihydropyrazine.
| Compound Name | 3,4,10,10a-tetrahydrochrysene;1,2-dihydropyrazine |
|---|---|
| PubChem CID | 175245625 |
| Molecular Formula | C22H22N2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 3,4,10,10a-tetrahydrochrysene;1,2-dihydropyrazine |
| SMILES | C1=CCC2C(=C1)C=Cc1c2ccc2c1CCC=C2.C1=CNCC=N1 |
| InChI | InChI=1S/C18H16.C4H6N2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-6-4-3-5-1/h1-3,5-6,9-12,15H,4,7-8H2;1-3,6H,4H2 |
| InChIKey | WNSJYTCJNSIBKP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |