C20H19Br — CID 174429973
1-bromo-4-ethyl-3,4,10,10a-tetrahydrochrysene (PubChem CID 174429973) has the molecular formula C20H19Br and a molecular weight of 339.28 g/mol. Its IUPAC name is 1-bromo-4-ethyl-3,4,10,10a-tetrahydrochrysene.
| Compound Name | 1-bromo-4-ethyl-3,4,10,10a-tetrahydrochrysene |
|---|---|
| PubChem CID | 174429973 |
| Molecular Formula | C20H19Br |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-bromo-4-ethyl-3,4,10,10a-tetrahydrochrysene |
| SMILES | CCC1CC=C(Br)c2ccc3c(c21)C=CC1=CC=CCC13 |
| InChI | InChI=1S/C20H19Br/c1-2-13-8-12-19(21)18-11-10-16-15-6-4-3-5-14(15)7-9-17(16)20(13)18/h3-5,7,9-13,15H,2,6,8H2,1H3 |
| InChIKey | SOHJFVXNYLUCCJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |