C20H24 — CID 153362578
(1Z,9Z,12Z)-15-methyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene;propane (PubChem CID 153362578) has the molecular formula C20H24 and a molecular weight of 264.41 g/mol. Its IUPAC name is (1Z,9Z,12Z)-15-methyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene;propane.
| Compound Name | (1Z,9Z,12Z)-15-methyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene;propane |
|---|---|
| PubChem CID | 153362578 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | (1Z,9Z,12Z)-15-methyltricyclo[6.6.2.04,16]hexadeca-1(14),2,4,6,8(16),9,12-heptaene;propane |
| SMILES | CC1/C2=C\C=C/C/C=C\c3cccc(c31)C=C2.CCC |
| InChI | InChI=1S/C17H16.C3H8/c1-13-14-7-4-2-3-5-8-15-9-6-10-16(12-11-14)17(13)15;1-3-2/h2,4-13H,3H2,1H3;3H2,1-2H3/b4-2-,8-5-,14-7-; |
| InChIKey | JBRWKLOVRWMLQZ-RXWIMFAZSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |