C11H6FeO5 — CID 175246431
1-hydroxy-3,4-dioxonaphthalene-2-carboxylic acid;iron (PubChem CID 175246431) has the molecular formula C11H6FeO5 and a molecular weight of 274.01 g/mol. Its IUPAC name is 1-hydroxy-3,4-dioxonaphthalene-2-carboxylic acid;iron.
| Compound Name | 1-hydroxy-3,4-dioxonaphthalene-2-carboxylic acid;iron |
|---|---|
| PubChem CID | 175246431 |
| Molecular Formula | C11H6FeO5 |
| Molecular Weight | 274.01 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | 1-hydroxy-3,4-dioxonaphthalene-2-carboxylic acid;iron |
| SMILES | O=C(O)C1=C(O)c2ccccc2C(=O)C1=O.[Fe] |
| InChI | InChI=1S/C11H6O5.Fe/c12-8-5-3-1-2-4-6(5)9(13)10(14)7(8)11(15)16;/h1-4,12H,(H,15,16); |
| InChIKey | UCVBJGBFYTYVFV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.01 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|