C18H13NO4 — CID 135784059
4-hydroxy-3-(4-methoxybenzenecarboximidoyl)naphthalene-1,2-dione (PubChem CID 135784059) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 4-hydroxy-3-(4-methoxybenzenecarboximidoyl)naphthalene-1,2-dione.
| Compound Name | 4-hydroxy-3-(4-methoxybenzenecarboximidoyl)naphthalene-1,2-dione |
|---|---|
| PubChem CID | 135784059 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 4-hydroxy-3-(4-methoxybenzenecarboximidoyl)naphthalene-1,2-dione |
| SMILES | [H]/N=C(/C1=C(O)c2ccccc2C(=O)C1=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H13NO4/c1-23-11-8-6-10(7-9-11)15(19)14-16(20)12-4-2-3-5-13(12)17(21)18(14)22/h2-9,19-20H,1H3/b19-15+ |
| InChIKey | JPJDNKJDNUQMHI-XDJHFCHBSA-N |
| XLogP | 2.80 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|