C18H15FN4O2 — CID 175248431
3-(4-fluoro-3-phenyl-2-prop-2-enoxyphenyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 175248431) has the molecular formula C18H15FN4O2 and a molecular weight of 338.34 g/mol. Its IUPAC name is 3-(4-fluoro-3-phenyl-2-prop-2-enoxyphenyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-(4-fluoro-3-phenyl-2-prop-2-enoxyphenyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 175248431 |
| Molecular Formula | C18H15FN4O2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3-(4-fluoro-3-phenyl-2-prop-2-enoxyphenyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | C=CCOc1c(-c2n[nH]c(C(N)=O)n2)ccc(F)c1-c1ccccc1 |
| InChI | InChI=1S/C18H15FN4O2/c1-2-10-25-15-12(17-21-18(16(20)24)23-22-17)8-9-13(19)14(15)11-6-4-3-5-7-11/h2-9H,1,10H2,(H2,20,24)(H,21,22,23) |
| InChIKey | JUCMZSZPMDBTBV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|