C19H12F8N4O2 — CID 11167536
3-[3-[5-fluoro-2-(2,2,3,3,4,4,4-heptafluorobutoxy)phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 11167536) has the molecular formula C19H12F8N4O2 and a molecular weight of 480.32 g/mol. Its IUPAC name is 3-[3-[5-fluoro-2-(2,2,3,3,4,4,4-heptafluorobutoxy)phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-[3-[5-fluoro-2-(2,2,3,3,4,4,4-heptafluorobutoxy)phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 11167536 |
| Molecular Formula | C19H12F8N4O2 |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 3-[3-[5-fluoro-2-(2,2,3,3,4,4,4-heptafluorobutoxy)phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccc(-c3cc(F)ccc3OCC(F)(F)C(F)(F)C(F)(F)F)c2)n[nH]1 |
| InChI | InChI=1S/C19H12F8N4O2/c20-11-4-5-13(33-8-17(21,22)18(23,24)19(25,26)27)12(7-11)9-2-1-3-10(6-9)15-29-16(14(28)32)31-30-15/h1-7H,8H2,(H2,28,32)(H,29,30,31) |
| InChIKey | XGVXQPWZGBWBNY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|