C22H29BrN4O2Si — CID 159416478
3-[3-(2-bromophenyl)phenyl]-1H-1,2,4-triazole-5-carboxamide;2-ethoxyethyl(trimethyl)silane (PubChem CID 159416478) has the molecular formula C22H29BrN4O2Si and a molecular weight of 489.49 g/mol. Its IUPAC name is 3-[3-(2-bromophenyl)phenyl]-1H-1,2,4-triazole-5-carboxamide;2-ethoxyethyl(trimethyl)silane.
| Compound Name | 3-[3-(2-bromophenyl)phenyl]-1H-1,2,4-triazole-5-carboxamide;2-ethoxyethyl(trimethyl)silane |
|---|---|
| PubChem CID | 159416478 |
| Molecular Formula | C22H29BrN4O2Si |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 3-[3-(2-bromophenyl)phenyl]-1H-1,2,4-triazole-5-carboxamide;2-ethoxyethyl(trimethyl)silane |
| SMILES | CCOCC[Si](C)(C)C.NC(=O)c1nc(-c2cccc(-c3ccccc3Br)c2)n[nH]1 |
| InChI | InChI=1S/C15H11BrN4O.C7H18OSi/c16-12-7-2-1-6-11(12)9-4-3-5-10(8-9)14-18-15(13(17)21)20-19-14;1-5-8-6-7-9(2,3)4/h1-8H,(H2,17,21)(H,18,19,20);5-7H2,1-4H3 |
| InChIKey | LPFLYNQAXQLZJT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|