C22H20N6O — CID 143049125
3-[3-[2-[3-(2-methylhydrazinyl)phenyl]phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 143049125) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[3-[2-[3-(2-methylhydrazinyl)phenyl]phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-[3-[2-[3-(2-methylhydrazinyl)phenyl]phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 143049125 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-[3-[2-[3-(2-methylhydrazinyl)phenyl]phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CNNc1cccc(-c2ccccc2-c2cccc(-c3n[nH]c(C(N)=O)n3)c2)c1 |
| InChI | InChI=1S/C22H20N6O/c1-24-26-17-9-5-7-15(13-17)19-11-3-2-10-18(19)14-6-4-8-16(12-14)21-25-22(20(23)29)28-27-21/h2-13,24,26H,1H3,(H2,23,29)(H,25,27,28) |
| InChIKey | BWRGESAMKAKFSV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|