C21H13F3N4O — CID 11463529
3-[3-[2-(2,3,4-trifluorophenyl)phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 11463529) has the molecular formula C21H13F3N4O and a molecular weight of 394.36 g/mol. Its IUPAC name is 3-[3-[2-(2,3,4-trifluorophenyl)phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-[3-[2-(2,3,4-trifluorophenyl)phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 11463529 |
| Molecular Formula | C21H13F3N4O |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 3-[3-[2-(2,3,4-trifluorophenyl)phenyl]phenyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccc(-c3ccccc3-c3ccc(F)c(F)c3F)c2)n[nH]1 |
| InChI | InChI=1S/C21H13F3N4O/c22-16-9-8-15(17(23)18(16)24)14-7-2-1-6-13(14)11-4-3-5-12(10-11)20-26-21(19(25)29)28-27-20/h1-10H,(H2,25,29)(H,26,27,28) |
| InChIKey | GFSPFUOSYASKRU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|