C21H15F6N3O3 — CID 11719762
6-[3-[5-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]phenyl]-4-methyl-5-oxopyrazine-2-carboxamide (PubChem CID 11719762) has the molecular formula C21H15F6N3O3 and a molecular weight of 471.36 g/mol. Its IUPAC name is 6-[3-[5-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]phenyl]-4-methyl-5-oxopyrazine-2-carboxamide.
| Compound Name | 6-[3-[5-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]phenyl]-4-methyl-5-oxopyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11719762 |
| Molecular Formula | C21H15F6N3O3 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 6-[3-[5-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]phenyl]-4-methyl-5-oxopyrazine-2-carboxamide |
| SMILES | Cn1cc(C(N)=O)nc(-c2cccc(-c3cc(F)ccc3OCC(F)(F)C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C21H15F6N3O3/c1-30-9-15(18(28)31)29-17(19(30)32)12-4-2-3-11(7-12)14-8-13(22)5-6-16(14)33-10-20(23,24)21(25,26)27/h2-9H,10H2,1H3,(H2,28,31) |
| InChIKey | IATLNPQNNKFMEM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|