C18H14F6N4O2 — CID 122574530
2-[3-amino-6-[5-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-1-yl]acetamide (PubChem CID 122574530) has the molecular formula C18H14F6N4O2 and a molecular weight of 432.32 g/mol. Its IUPAC name is 2-[3-amino-6-[5-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-1-yl]acetamide.
| Compound Name | 2-[3-amino-6-[5-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-1-yl]acetamide |
|---|---|
| PubChem CID | 122574530 |
| Molecular Formula | C18H14F6N4O2 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-[3-amino-6-[5-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-1-yl]acetamide |
| SMILES | NC(=O)Cn1nc(N)c2ccc(-c3cc(F)ccc3OCC(F)(F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H14F6N4O2/c19-10-2-4-14(30-8-17(20,21)18(22,23)24)12(6-10)9-1-3-11-13(5-9)28(7-15(25)29)27-16(11)26/h1-6H,7-8H2,(H2,25,29)(H2,26,27) |
| InChIKey | DRIABLUOLKTGOP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|