About azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride
azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride (PubChem CID 175251541) has the molecular formula C4H14Cl2N2O3
and a molecular weight of 209.07 g/mol. Its IUPAC name is azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride.
Molecular Properties
| Compound Name | azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride |
| PubChem CID | 175251541 |
| Molecular Formula | C4H14Cl2N2O3 |
| Molecular Weight | 209.07 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride |
| SMILES | CCON(O)C(C)=O.Cl.Cl.N |
| InChI | InChI=1S/C4H9NO3.2ClH.H3N/c1-3-8-5(7)4(2)6;;;/h7H,3H2,1-2H3;2*1H;1H3 |
| InChIKey | OVEKVDBZEUVFKM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.07 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride?
The IUPAC name of azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride (CID 175251541) is azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride.
What is the SMILES notation for azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride?
The canonical SMILES for azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride is CCON(O)C(C)=O.Cl.Cl.N.
What is the InChIKey of azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride?
The InChIKey is OVEKVDBZEUVFKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3.2ClH.H3N/c1-3-8-5(7)4(2)6;;;/h7H,3H2,1-2H3;2*1H;1H3.
What are the key properties of azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride?
azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride has a molecular weight of 209.07 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-ethoxy-N-hydroxyacetamide;dihydrochloride is sourced from PubChem (CID 175251541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).