C26H26N2O5 — CID 175255452
2,4-dimethoxybenzamide;1-(2-phenylethyl)indole-3-carboxylic acid (PubChem CID 175255452) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2,4-dimethoxybenzamide;1-(2-phenylethyl)indole-3-carboxylic acid.
| Compound Name | 2,4-dimethoxybenzamide;1-(2-phenylethyl)indole-3-carboxylic acid |
|---|---|
| PubChem CID | 175255452 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2,4-dimethoxybenzamide;1-(2-phenylethyl)indole-3-carboxylic acid |
| SMILES | COc1ccc(C(N)=O)c(OC)c1.O=C(O)c1cn(CCc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C17H15NO2.C9H11NO3/c19-17(20)15-12-18(16-9-5-4-8-14(15)16)11-10-13-6-2-1-3-7-13;1-12-6-3-4-7(9(10)11)8(5-6)13-2/h1-9,12H,10-11H2,(H,19,20);3-5H,1-2H3,(H2,10,11) |
| InChIKey | PSXUHXHOHRDXHJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |