C23H27N3O3 — CID 175256655
[1-(1H-imidazol-2-yl)-2-(4-phenylmethoxyphenyl)ethyl] N-tert-butylcarbamate (PubChem CID 175256655) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is [1-(1H-imidazol-2-yl)-2-(4-phenylmethoxyphenyl)ethyl] N-tert-butylcarbamate.
| Compound Name | [1-(1H-imidazol-2-yl)-2-(4-phenylmethoxyphenyl)ethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175256655 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | [1-(1H-imidazol-2-yl)-2-(4-phenylmethoxyphenyl)ethyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(Cc1ccc(OCc2ccccc2)cc1)c1ncc[nH]1 |
| InChI | InChI=1S/C23H27N3O3/c1-23(2,3)26-22(27)29-20(21-24-13-14-25-21)15-17-9-11-19(12-10-17)28-16-18-7-5-4-6-8-18/h4-14,20H,15-16H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | HLUCEXVRBFIIMT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |