C12H14N2S — CID 175257011
N-benzyl-4-ethyl-1,3-thiazol-5-amine (PubChem CID 175257011) has the molecular formula C12H14N2S and a molecular weight of 218.33 g/mol. Its IUPAC name is N-benzyl-4-ethyl-1,3-thiazol-5-amine.
| Compound Name | N-benzyl-4-ethyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 175257011 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | N-benzyl-4-ethyl-1,3-thiazol-5-amine |
| SMILES | CCc1ncsc1NCc1ccccc1 |
| InChI | InChI=1S/C12H14N2S/c1-2-11-12(15-9-14-11)13-8-10-6-4-3-5-7-10/h3-7,9,13H,2,8H2,1H3 |
| InChIKey | SHOZVOZLPBTLGF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |