C16H17NO5 — CID 175257650
2-methoxy-5-[(E)-3-oxo-3-(2-oxopiperidin-1-yl)prop-1-enyl]benzoic acid (PubChem CID 175257650) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-methoxy-5-[(E)-3-oxo-3-(2-oxopiperidin-1-yl)prop-1-enyl]benzoic acid.
| Compound Name | 2-methoxy-5-[(E)-3-oxo-3-(2-oxopiperidin-1-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 175257650 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-methoxy-5-[(E)-3-oxo-3-(2-oxopiperidin-1-yl)prop-1-enyl]benzoic acid |
| SMILES | COc1ccc(/C=C/C(=O)N2CCCCC2=O)cc1C(=O)O |
| InChI | InChI=1S/C16H17NO5/c1-22-13-7-5-11(10-12(13)16(20)21)6-8-15(19)17-9-3-2-4-14(17)18/h5-8,10H,2-4,9H2,1H3,(H,20,21)/b8-6+ |
| InChIKey | RMRCAGVUYWNOGY-SOFGYWHQSA-N |
| XLogP | 1.95 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|