C25H17F6NO2S — CID 175262396
2-[6-ethylsulfonyl-3-phenyl-2-(trifluoromethyl)phenyl]-8-(trifluoromethyl)quinoline (PubChem CID 175262396) has the molecular formula C25H17F6NO2S and a molecular weight of 509.47 g/mol. Its IUPAC name is 2-[6-ethylsulfonyl-3-phenyl-2-(trifluoromethyl)phenyl]-8-(trifluoromethyl)quinoline.
| Compound Name | 2-[6-ethylsulfonyl-3-phenyl-2-(trifluoromethyl)phenyl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 175262396 |
| Molecular Formula | C25H17F6NO2S |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 2-[6-ethylsulfonyl-3-phenyl-2-(trifluoromethyl)phenyl]-8-(trifluoromethyl)quinoline |
| SMILES | CCS(=O)(=O)c1ccc(-c2ccccc2)c(C(F)(F)F)c1-c1ccc2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C25H17F6NO2S/c1-2-35(33,34)20-14-12-17(15-7-4-3-5-8-15)22(25(29,30)31)21(20)19-13-11-16-9-6-10-18(23(16)32-19)24(26,27)28/h3-14H,2H2,1H3 |
| InChIKey | VIXMGNHPTYRGOF-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |