C25H17F6NO2S — CID 174583269
[2-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]-4-phenyl-3-(trifluoromethyl)phenyl]methanesulfinic acid (PubChem CID 174583269) has the molecular formula C25H17F6NO2S and a molecular weight of 509.47 g/mol. Its IUPAC name is [2-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]-4-phenyl-3-(trifluoromethyl)phenyl]methanesulfinic acid.
| Compound Name | [2-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]-4-phenyl-3-(trifluoromethyl)phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174583269 |
| Molecular Formula | C25H17F6NO2S |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | [2-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]-4-phenyl-3-(trifluoromethyl)phenyl]methanesulfinic acid |
| SMILES | Cc1cnc2c(C(F)(F)F)cccc2c1-c1c(CS(=O)O)ccc(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C25H17F6NO2S/c1-14-12-32-23-18(8-5-9-19(23)24(26,27)28)20(14)21-16(13-35(33)34)10-11-17(22(21)25(29,30)31)15-6-3-2-4-7-15/h2-12H,13H2,1H3,(H,33,34) |
| InChIKey | QBQCKNPCSCRYQN-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|