C21H14F3N2O2S2- — CID 174598824
[3-[2-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]-1,3-thiazol-5-yl]phenyl]methanesulfinate (PubChem CID 174598824) has the molecular formula C21H14F3N2O2S2- and a molecular weight of 447.48 g/mol. Its IUPAC name is [3-[2-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]-1,3-thiazol-5-yl]phenyl]methanesulfinate.
| Compound Name | [3-[2-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]-1,3-thiazol-5-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174598824 |
| Molecular Formula | C21H14F3N2O2S2- |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | [3-[2-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]-1,3-thiazol-5-yl]phenyl]methanesulfinate |
| SMILES | Cc1cnc2c(C(F)(F)F)cccc2c1-c1ncc(-c2cccc(CS(=O)[O-])c2)s1 |
| InChI | InChI=1S/C21H15F3N2O2S2/c1-12-9-25-19-15(6-3-7-16(19)21(22,23)24)18(12)20-26-10-17(29-20)14-5-2-4-13(8-14)11-30(27)28/h2-10H,11H2,1H3,(H,27,28)/p-1 |
| InChIKey | HOAJTVOJETVUSR-UHFFFAOYSA-M |
| XLogP | 5.73 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|