C22H14F3NOS — CID 66914336
(3-methylthiophen-2-yl)-[4-phenyl-8-(trifluoromethyl)quinolin-3-yl]methanone (PubChem CID 66914336) has the molecular formula C22H14F3NOS and a molecular weight of 397.42 g/mol. Its IUPAC name is (3-methylthiophen-2-yl)-[4-phenyl-8-(trifluoromethyl)quinolin-3-yl]methanone.
| Compound Name | (3-methylthiophen-2-yl)-[4-phenyl-8-(trifluoromethyl)quinolin-3-yl]methanone |
|---|---|
| PubChem CID | 66914336 |
| Molecular Formula | C22H14F3NOS |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (3-methylthiophen-2-yl)-[4-phenyl-8-(trifluoromethyl)quinolin-3-yl]methanone |
| SMILES | Cc1ccsc1C(=O)c1cnc2c(C(F)(F)F)cccc2c1-c1ccccc1 |
| InChI | InChI=1S/C22H14F3NOS/c1-13-10-11-28-21(13)20(27)16-12-26-19-15(8-5-9-17(19)22(23,24)25)18(16)14-6-3-2-4-7-14/h2-12H,1H3 |
| InChIKey | XIYGXLNZNCLEQL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |