C28H18F3N3O2S — CID 66914514
1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-thiophen-3-ylurea (PubChem CID 66914514) has the molecular formula C28H18F3N3O2S and a molecular weight of 517.53 g/mol. Its IUPAC name is 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-thiophen-3-ylurea.
| Compound Name | 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-thiophen-3-ylurea |
|---|---|
| PubChem CID | 66914514 |
| Molecular Formula | C28H18F3N3O2S |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-thiophen-3-ylurea |
| SMILES | O=C(Nc1ccsc1)Nc1cccc(-c2c(C(=O)c3ccccc3)cnc3c(C(F)(F)F)cccc23)c1 |
| InChI | InChI=1S/C28H18F3N3O2S/c29-28(30,31)23-11-5-10-21-24(22(15-32-25(21)23)26(35)17-6-2-1-3-7-17)18-8-4-9-19(14-18)33-27(36)34-20-12-13-37-16-20/h1-16H,(H2,33,34,36) |
| InChIKey | ZTRMEVQIINCZBW-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |