C30H19F4N3OS — CID 11353296
1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(4-fluorophenyl)thiourea (PubChem CID 11353296) has the molecular formula C30H19F4N3OS and a molecular weight of 545.56 g/mol. Its IUPAC name is 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 11353296 |
| Molecular Formula | C30H19F4N3OS |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(4-fluorophenyl)thiourea |
| SMILES | O=C(c1ccccc1)c1cnc2c(C(F)(F)F)cccc2c1-c1cccc(NC(=S)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C30H19F4N3OS/c31-20-12-14-21(15-13-20)36-29(39)37-22-9-4-8-19(16-22)26-23-10-5-11-25(30(32,33)34)27(23)35-17-24(26)28(38)18-6-2-1-3-7-18/h1-17H,(H2,36,37,39) |
| InChIKey | WSXAVYOJIYEJJJ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|