C30H19ClF3N3O4S — CID 66914409
1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(4-chlorophenyl)sulfonylurea (PubChem CID 66914409) has the molecular formula C30H19ClF3N3O4S and a molecular weight of 610.01 g/mol. Its IUPAC name is 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(4-chlorophenyl)sulfonylurea.
| Compound Name | 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(4-chlorophenyl)sulfonylurea |
|---|---|
| PubChem CID | 66914409 |
| Molecular Formula | C30H19ClF3N3O4S |
| Molecular Weight | 610.01 g/mol |
| Exact Mass | 609.07 |
| IUPAC Name | 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(4-chlorophenyl)sulfonylurea |
| SMILES | O=C(Nc1cccc(-c2c(C(=O)c3ccccc3)cnc3c(C(F)(F)F)cccc23)c1)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H19ClF3N3O4S/c31-20-12-14-22(15-13-20)42(40,41)37-29(39)36-21-9-4-8-19(16-21)26-23-10-5-11-25(30(32,33)34)27(23)35-17-24(26)28(38)18-6-2-1-3-7-18/h1-17H,(H2,36,37,39) |
| InChIKey | NGXKYHMMMHFECG-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.01 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |