C31H21F4N3O2 — CID 66914239
1-[[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]methyl]-3-(2-fluorophenyl)urea (PubChem CID 66914239) has the molecular formula C31H21F4N3O2 and a molecular weight of 543.52 g/mol. Its IUPAC name is 1-[[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]methyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]methyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 66914239 |
| Molecular Formula | C31H21F4N3O2 |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 1-[[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]methyl]-3-(2-fluorophenyl)urea |
| SMILES | O=C(NCc1cccc(-c2c(C(=O)c3ccccc3)cnc3c(C(F)(F)F)cccc23)c1)Nc1ccccc1F |
| InChI | InChI=1S/C31H21F4N3O2/c32-25-14-4-5-15-26(25)38-30(40)37-17-19-8-6-11-21(16-19)27-22-12-7-13-24(31(33,34)35)28(22)36-18-23(27)29(39)20-9-2-1-3-10-20/h1-16,18H,17H2,(H2,37,38,40) |
| InChIKey | QGWWFHSNDYWMHS-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |