C26H21F3N2O — CID 90749427
N-[(3-ethylphenyl)methyl]-4-phenyl-8-(trifluoromethyl)quinoline-3-carboxamide (PubChem CID 90749427) has the molecular formula C26H21F3N2O and a molecular weight of 434.46 g/mol. Its IUPAC name is N-[(3-ethylphenyl)methyl]-4-phenyl-8-(trifluoromethyl)quinoline-3-carboxamide.
| Compound Name | N-[(3-ethylphenyl)methyl]-4-phenyl-8-(trifluoromethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 90749427 |
| Molecular Formula | C26H21F3N2O |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[(3-ethylphenyl)methyl]-4-phenyl-8-(trifluoromethyl)quinoline-3-carboxamide |
| SMILES | CCc1cccc(CNC(=O)c2cnc3c(C(F)(F)F)cccc3c2-c2ccccc2)c1 |
| InChI | InChI=1S/C26H21F3N2O/c1-2-17-8-6-9-18(14-17)15-31-25(32)21-16-30-24-20(12-7-13-22(24)26(27,28)29)23(21)19-10-4-3-5-11-19/h3-14,16H,2,15H2,1H3,(H,31,32) |
| InChIKey | JBCSHQHOQQMWRL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |