C24H17F3N2O — CID 66914315
N-methyl-N,4-diphenyl-8-(trifluoromethyl)quinoline-3-carboxamide (PubChem CID 66914315) has the molecular formula C24H17F3N2O and a molecular weight of 406.41 g/mol. Its IUPAC name is N-methyl-N,4-diphenyl-8-(trifluoromethyl)quinoline-3-carboxamide.
| Compound Name | N-methyl-N,4-diphenyl-8-(trifluoromethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 66914315 |
| Molecular Formula | C24H17F3N2O |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-methyl-N,4-diphenyl-8-(trifluoromethyl)quinoline-3-carboxamide |
| SMILES | CN(C(=O)c1cnc2c(C(F)(F)F)cccc2c1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H17F3N2O/c1-29(17-11-6-3-7-12-17)23(30)19-15-28-22-18(13-8-14-20(22)24(25,26)27)21(19)16-9-4-2-5-10-16/h2-15H,1H3 |
| InChIKey | AHUYRAWHQQNQIN-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |