C30H19F4N3O2 — CID 66914238
1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(3-fluorophenyl)urea (PubChem CID 66914238) has the molecular formula C30H19F4N3O2 and a molecular weight of 529.49 g/mol. Its IUPAC name is 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 66914238 |
| Molecular Formula | C30H19F4N3O2 |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 1-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(Nc1cccc(F)c1)Nc1cccc(-c2c(C(=O)c3ccccc3)cnc3c(C(F)(F)F)cccc23)c1 |
| InChI | InChI=1S/C30H19F4N3O2/c31-20-10-5-12-22(16-20)37-29(39)36-21-11-4-9-19(15-21)26-23-13-6-14-25(30(32,33)34)27(23)35-17-24(26)28(38)18-7-2-1-3-8-18/h1-17H,(H2,36,37,39) |
| InChIKey | WIQMUHIPNMBIRC-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |