C31H20F4N2O2 — CID 66913489
N-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-2-(2-fluorophenyl)acetamide (PubChem CID 66913489) has the molecular formula C31H20F4N2O2 and a molecular weight of 528.51 g/mol. Its IUPAC name is N-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 66913489 |
| Molecular Formula | C31H20F4N2O2 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | N-[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]-2-(2-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1F)Nc1cccc(-c2c(C(=O)c3ccccc3)cnc3c(C(F)(F)F)cccc23)c1 |
| InChI | InChI=1S/C31H20F4N2O2/c32-26-15-5-4-10-20(26)17-27(38)37-22-12-6-11-21(16-22)28-23-13-7-14-25(31(33,34)35)29(23)36-18-24(28)30(39)19-8-2-1-3-9-19/h1-16,18H,17H2,(H,37,38) |
| InChIKey | RPPWMLJUJLSGRN-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |